| CAS No.: | 619-73-8 |
|---|---|
| Formula: | C7h7no3 |
| EINECS: | 210-611-6 |
| Type: | Synthesis Material Intermediates |
| Appearance: | Powder |
| Quality: | Refined |
| Samples: |
|---|
Suppliers with verified business licenses
Audited Supplier
| Properties | |
| Density | 1.3585 (rough estimate) |
| Melting Point | 92-94°C(lit.) |
| Boling Point | 185°C12mm Hg(lit.) |
| Flash Point | 180 °C |
| Water Solubility | Soluble in water (2 mg/ml at 20°C). |
| Solubility | 2g/l |
| Vapor Presure | 0.000128mmHg at 25°C |
| Appearance | Crystalline Powder |
| Color | Yellow |
| BRN | 1424026 |
| Refractive index | 1.5030 (estimate) |
| pKa | 13.61±0.10(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.5030 (estimate) |
| Properties | Soluble in ethanol, ether, slightly soluble in water. |
| Use | Used as an intermediate in organic synthesis |
| InChI | InChI=1/C7H7NO3/c9-5-6-1-3-7(4-2-6)8(10)11/h1-4,9H,5H2 |
| InChIKey | JKTYGPATCNUWKN-UHFFFAOYSA-N |
Suppliers with verified business licenses
Audited Supplier 
){kind=link}
){kind=link}